About 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide
5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide (PubChem CID 2738482) has the molecular formula C23H20N4O2
and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide |
| PubChem CID | 2738482 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C23H20N4O2/c1-17-21(22(26-29-17)18-9-3-2-4-10-18)23(28)27(15-19-11-5-7-13-24-19)16-20-12-6-8-14-25-20/h2-14H,15-16H2,1H3 |
| InChIKey | BDGPWLXRDVOTRL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide?
The IUPAC name of 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide (CID 2738482) is 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide?
The canonical SMILES for 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide is Cc1onc(-c2ccccc2)c1C(=O)N(Cc1ccccn1)Cc1ccccn1.
What is the InChIKey of 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide?
The InChIKey is BDGPWLXRDVOTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O2/c1-17-21(22(26-29-17)18-9-3-2-4-10-18)23(28)27(15-19-11-5-7-13-24-19)16-20-12-6-8-14-25-20/h2-14H,15-16H2,1H3.
What are the key properties of 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide?
5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide has a molecular weight of 384.44 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 2738482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).