About 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide
5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 2738484) has the molecular formula C22H18N4O2
and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 2738484 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(c1ncoc1-c1ccccc1)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C22H18N4O2/c27-22(20-21(28-16-25-20)17-8-2-1-3-9-17)26(14-18-10-4-6-12-23-18)15-19-11-5-7-13-24-19/h1-13,16H,14-15H2 |
| InChIKey | HWKJOIKOJQLIRL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide (CID 2738484) is 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide is O=C(c1ncoc1-c1ccccc1)N(Cc1ccccn1)Cc1ccccn1.
What is the InChIKey of 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is HWKJOIKOJQLIRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O2/c27-22(20-21(28-16-25-20)17-8-2-1-3-9-17)26(14-18-10-4-6-12-23-18)15-19-11-5-7-13-24-19/h1-13,16H,14-15H2.
What are the key properties of 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 370.41 g/mol, XLogP of 3.97, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-N,N-bis(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 2738484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).