C18H25N3O2S2 — CID 2738607
2,5-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiophene-3-sulfonamide (PubChem CID 2738607) has the molecular formula C18H25N3O2S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 2738607 |
| Molecular Formula | C18H25N3O2S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2,5-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2ccc(N3CCN(C)CC3)cc2)c(C)s1 |
| InChI | InChI=1S/C18H25N3O2S2/c1-14-12-18(15(2)24-14)25(22,23)19-13-16-4-6-17(7-5-16)21-10-8-20(3)9-11-21/h4-7,12,19H,8-11,13H2,1-3H3 |
| InChIKey | JEPYDRIKKCWFRT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|