C21H20N2O3 — CID 2738719
N-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-yl)-2H-chromene-3-carboxamide (PubChem CID 2738719) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-yl)-2H-chromene-3-carboxamide.
| Compound Name | N-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-yl)-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 2738719 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-yl)-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCC1CCCN21)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C21H20N2O3/c24-21(15-10-14-4-1-2-6-19(14)25-12-15)22-16-7-8-18-20(11-16)26-13-17-5-3-9-23(17)18/h1-2,4,6-8,10-11,17H,3,5,9,12-13H2,(H,22,24) |
| InChIKey | BRXCTPUPFBQDDV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |