C12H15N3O4S3 — CID 2738725
2,4-dimethyl-N-[(4-sulfamoylphenyl)methyl]-1,3-thiazole-5-sulfonamide (PubChem CID 2738725) has the molecular formula C12H15N3O4S3 and a molecular weight of 361.47 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(4-sulfamoylphenyl)methyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2,4-dimethyl-N-[(4-sulfamoylphenyl)methyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 2738725 |
| Molecular Formula | C12H15N3O4S3 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2,4-dimethyl-N-[(4-sulfamoylphenyl)methyl]-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(C)c(S(=O)(=O)NCc2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C12H15N3O4S3/c1-8-12(20-9(2)15-8)22(18,19)14-7-10-3-5-11(6-4-10)21(13,16)17/h3-6,14H,7H2,1-2H3,(H2,13,16,17) |
| InChIKey | XGXRNKBKJSUSMI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |