About 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one
2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one (PubChem CID 2738783) has the molecular formula C16H16F3NO
and a molecular weight of 295.30 g/mol. Its IUPAC name is 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one.
Molecular Properties
| Compound Name | 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one |
| PubChem CID | 2738783 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one |
| SMILES | O=C1C2CCN(CC2)C12CC2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3NO/c17-16(18,19)12-3-1-10(2-4-12)13-9-15(13)14(21)11-5-7-20(15)8-6-11/h1-4,11,13H,5-9H2 |
| InChIKey | MMMYWHJDJNRVGE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one?
The IUPAC name of 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one (CID 2738783) is 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one.
What is the SMILES notation for 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one?
The canonical SMILES for 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one is O=C1C2CCN(CC2)C12CC2c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one?
The InChIKey is MMMYWHJDJNRVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3NO/c17-16(18,19)12-3-1-10(2-4-12)13-9-15(13)14(21)11-5-7-20(15)8-6-11/h1-4,11,13H,5-9H2.
What are the key properties of 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one?
2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one has a molecular weight of 295.30 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-[4-(trifluoromethyl)phenyl]spiro[1-azabicyclo[2.2.2]octane-2,1'-cyclopropane]-3-one is sourced from PubChem (CID 2738783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).