C17H22N4O3 — CID 2738944
N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 2738944) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 2738944 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3c(C)noc3C)CC2)cc1 |
| InChI | InChI=1S/C17H22N4O3/c1-12-16(13(2)24-19-12)18-17(22)21-10-8-20(9-11-21)14-4-6-15(23-3)7-5-14/h4-7H,8-11H2,1-3H3,(H,18,22) |
| InChIKey | ADHDGXTZGOBXMW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|