C21H33N5O4S — CID 27390185
(5R,6S)-3-[[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 27390185) has the molecular formula C21H33N5O4S and a molecular weight of 451.59 g/mol. Its IUPAC name is (5R,6S)-3-[[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6S)-3-[[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 27390185 |
| Molecular Formula | C21H33N5O4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (5R,6S)-3-[[[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)CN1C(=O)N[C@@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C21H33N5O4S/c1-14-7-5-6-9-21(14)19(27)25(20(28)22-21)13-24(4)11-18-15(2)23-26(16(18)3)17-8-10-31(29,30)12-17/h14,17H,5-13H2,1-4H3,(H,22,28)/t14-,17+,21+/m0/s1 |
| InChIKey | LOFRENRGPXCCQU-AVBTWRTFSA-N |
| XLogP | 1.75 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|