About 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole
4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole (PubChem CID 2739035) has the molecular formula C11H10Cl2N2S
and a molecular weight of 273.19 g/mol. Its IUPAC name is 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole |
| PubChem CID | 2739035 |
| Molecular Formula | C11H10Cl2N2S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole |
| SMILES | Clc1cc(Cl)c2nc(N3CCCC3)sc2c1 |
| InChI | InChI=1S/C11H10Cl2N2S/c12-7-5-8(13)10-9(6-7)16-11(14-10)15-3-1-2-4-15/h5-6H,1-4H2 |
| InChIKey | CBWZVHLZQNPZMS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole?
The IUPAC name of 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole (CID 2739035) is 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole.
What is the SMILES notation for 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole?
The canonical SMILES for 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole is Clc1cc(Cl)c2nc(N3CCCC3)sc2c1.
What is the InChIKey of 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole?
The InChIKey is CBWZVHLZQNPZMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2N2S/c12-7-5-8(13)10-9(6-7)16-11(14-10)15-3-1-2-4-15/h5-6H,1-4H2.
What are the key properties of 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole?
4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole has a molecular weight of 273.19 g/mol, XLogP of 4.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2-pyrrolidin-1-yl-1,3-benzothiazole is sourced from PubChem (CID 2739035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).