About N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide
N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide (PubChem CID 2739368) has the molecular formula C12H18N2S2
and a molecular weight of 254.42 g/mol. Its IUPAC name is N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide.
Molecular Properties
| Compound Name | N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide |
| PubChem CID | 2739368 |
| Molecular Formula | C12H18N2S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide |
| SMILES | CCCC1c2ccsc2CCN1C(=S)NC |
| InChI | InChI=1S/C12H18N2S2/c1-3-4-10-9-6-8-16-11(9)5-7-14(10)12(15)13-2/h6,8,10H,3-5,7H2,1-2H3,(H,13,15) |
| InChIKey | CZAMDQHGPVQUGN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide?
The IUPAC name of N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide (CID 2739368) is N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide.
What is the SMILES notation for N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide?
The canonical SMILES for N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide is CCCC1c2ccsc2CCN1C(=S)NC.
What is the InChIKey of N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide?
The InChIKey is CZAMDQHGPVQUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2S2/c1-3-4-10-9-6-8-16-11(9)5-7-14(10)12(15)13-2/h6,8,10H,3-5,7H2,1-2H3,(H,13,15).
What are the key properties of N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide?
N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide has a molecular weight of 254.42 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-propyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide is sourced from PubChem (CID 2739368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).