About 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea
1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea (PubChem CID 2739469) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea.
Molecular Properties
| Compound Name | 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea |
| PubChem CID | 2739469 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea |
| SMILES | CCCCNC(=O)Nc1cccc(-c2nnco2)c1 |
| InChI | InChI=1S/C13H16N4O2/c1-2-3-7-14-13(18)16-11-6-4-5-10(8-11)12-17-15-9-19-12/h4-6,8-9H,2-3,7H2,1H3,(H2,14,16,18) |
| InChIKey | SJYHVHQGAJYESC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea?
The IUPAC name of 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea (CID 2739469) is 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea.
What is the SMILES notation for 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea?
The canonical SMILES for 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea is CCCCNC(=O)Nc1cccc(-c2nnco2)c1.
What is the InChIKey of 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea?
The InChIKey is SJYHVHQGAJYESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-2-3-7-14-13(18)16-11-6-4-5-10(8-11)12-17-15-9-19-12/h4-6,8-9H,2-3,7H2,1H3,(H2,14,16,18).
What are the key properties of 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea?
1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea has a molecular weight of 260.30 g/mol, XLogP of 2.66, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea is sourced from PubChem (CID 2739469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).