C13H12Cl3N3O — CID 2739557
2,4,6-trichloro-N-[1-(2,4-dimethyl-1,3-oxazol-5-yl)ethylideneamino]aniline (PubChem CID 2739557) has the molecular formula C13H12Cl3N3O and a molecular weight of 332.62 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[1-(2,4-dimethyl-1,3-oxazol-5-yl)ethylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[1-(2,4-dimethyl-1,3-oxazol-5-yl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 2739557 |
| Molecular Formula | C13H12Cl3N3O |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2,4,6-trichloro-N-[1-(2,4-dimethyl-1,3-oxazol-5-yl)ethylideneamino]aniline |
| SMILES | CC(=NNc1c(Cl)cc(Cl)cc1Cl)c1oc(C)nc1C |
| InChI | InChI=1S/C13H12Cl3N3O/c1-6-13(20-8(3)17-6)7(2)18-19-12-10(15)4-9(14)5-11(12)16/h4-5,19H,1-3H3 |
| InChIKey | WOFNYGSEMXTBIK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|