About N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline
N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline (PubChem CID 2739613) has the molecular formula C19H17F2N3
and a molecular weight of 325.36 g/mol. Its IUPAC name is N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline.
Molecular Properties
| Compound Name | N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline |
| PubChem CID | 2739613 |
| Molecular Formula | C19H17F2N3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline |
| SMILES | Cc1ccc(C)n1-c1ccc(C=NNc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H17F2N3/c1-13-3-4-14(2)24(13)17-8-5-15(6-9-17)12-22-23-19-10-7-16(20)11-18(19)21/h3-12,23H,1-2H3 |
| InChIKey | WKLHEXSIZBTBEA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline?
The IUPAC name of N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline (CID 2739613) is N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline.
What is the SMILES notation for N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline?
The canonical SMILES for N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline is Cc1ccc(C)n1-c1ccc(C=NNc2ccc(F)cc2F)cc1.
What is the InChIKey of N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline?
The InChIKey is WKLHEXSIZBTBEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3/c1-13-3-4-14(2)24(13)17-8-5-15(6-9-17)12-22-23-19-10-7-16(20)11-18(19)21/h3-12,23H,1-2H3.
What are the key properties of N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline?
N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline has a molecular weight of 325.36 g/mol, XLogP of 4.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(2,5-dimethylpyrrol-1-yl)phenyl]methylideneamino]-2,4-difluoroaniline is sourced from PubChem (CID 2739613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).