C12H14N4O3S3 — CID 27396134
1-(benzenesulfonamido)-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea (PubChem CID 27396134) has the molecular formula C12H14N4O3S3 and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-(benzenesulfonamido)-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea.
| Compound Name | 1-(benzenesulfonamido)-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 27396134 |
| Molecular Formula | C12H14N4O3S3 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-(benzenesulfonamido)-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea |
| SMILES | Cc1c(NC(=O)NNS(=O)(=O)c2ccccc2)sc(=S)n1C |
| InChI | InChI=1S/C12H14N4O3S3/c1-8-10(21-12(20)16(8)2)13-11(17)14-15-22(18,19)9-6-4-3-5-7-9/h3-7,15H,1-2H3,(H2,13,14,17) |
| InChIKey | NNOWEVWRXWPGHY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|