C18H21N7O3 — CID 27396194
2-N,2-N-dimethyl-6-[6-[2-(4-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine (PubChem CID 27396194) has the molecular formula C18H21N7O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[6-[2-(4-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[6-[2-(4-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 27396194 |
| Molecular Formula | C18H21N7O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[6-[2-(4-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(OCCOc2ccc(Oc3nc(N)nc(N(C)C)n3)nn2)cc1 |
| InChI | InChI=1S/C18H21N7O3/c1-12-4-6-13(7-5-12)26-10-11-27-14-8-9-15(24-23-14)28-18-21-16(19)20-17(22-18)25(2)3/h4-9H,10-11H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | VMFOUSRWFXPDRM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|