C8H13N5O — CID 27396198
2-N,2-N-dimethyl-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine (PubChem CID 27396198) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 27396198 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-N,2-N-dimethyl-6-prop-2-enoxy-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCOc1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C8H13N5O/c1-4-5-14-8-11-6(9)10-7(12-8)13(2)3/h4H,1,5H2,2-3H3,(H2,9,10,11,12) |
| InChIKey | YQJOKSKMAJDZOX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|