About N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine
N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine (PubChem CID 27396202) has the molecular formula C16H26N6O
and a molecular weight of 318.43 g/mol. Its IUPAC name is N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine.
Molecular Properties
| Compound Name | N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine |
| PubChem CID | 27396202 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine |
| SMILES | CC(C)=NOc1nc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C16H26N6O/c1-13(2)20-23-16-18-14(21-9-5-3-6-10-21)17-15(19-16)22-11-7-4-8-12-22/h3-12H2,1-2H3 |
| InChIKey | GFTZAWKQILQYFN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine?
The IUPAC name of N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine (CID 27396202) is N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine.
What is the SMILES notation for N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine?
The canonical SMILES for N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine is CC(C)=NOc1nc(N2CCCCC2)nc(N2CCCCC2)n1.
What is the InChIKey of N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine?
The InChIKey is GFTZAWKQILQYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N6O/c1-13(2)20-23-16-18-14(21-9-5-3-6-10-21)17-15(19-16)22-11-7-4-8-12-22/h3-12H2,1-2H3.
What are the key properties of N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine?
N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine has a molecular weight of 318.43 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]propan-2-imine is sourced from PubChem (CID 27396202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).