About methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate
methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate (PubChem CID 2739669) has the molecular formula C13H9ClO4S2
and a molecular weight of 328.80 g/mol. Its IUPAC name is methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate |
| PubChem CID | 2739669 |
| Molecular Formula | C13H9ClO4S2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)-c1cc(Cl)ccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C13H9ClO4S2/c1-18-13(15)10-4-7-6-20(16,17)11-3-2-8(14)5-9(11)12(7)19-10/h2-5H,6H2,1H3 |
| InChIKey | FFZLAKKWPAAFOQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate?
The IUPAC name of methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate (CID 2739669) is methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate.
What is the SMILES notation for methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate?
The canonical SMILES for methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate is COC(=O)c1cc2c(s1)-c1cc(Cl)ccc1S(=O)(=O)C2.
What is the InChIKey of methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate?
The InChIKey is FFZLAKKWPAAFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClO4S2/c1-18-13(15)10-4-7-6-20(16,17)11-3-2-8(14)5-9(11)12(7)19-10/h2-5H,6H2,1H3.
What are the key properties of methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate?
methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate has a molecular weight of 328.80 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-chloro-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxylate is sourced from PubChem (CID 2739669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).