C13H10N2O3S — CID 2739720
methyl 3-[5-(1H-pyrazol-5-yl)furan-2-yl]thiophene-2-carboxylate (PubChem CID 2739720) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl 3-[5-(1H-pyrazol-5-yl)furan-2-yl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[5-(1H-pyrazol-5-yl)furan-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2739720 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | methyl 3-[5-(1H-pyrazol-5-yl)furan-2-yl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1-c1ccc(-c2ccn[nH]2)o1 |
| InChI | InChI=1S/C13H10N2O3S/c1-17-13(16)12-8(5-7-19-12)10-2-3-11(18-10)9-4-6-14-15-9/h2-7H,1H3,(H,14,15) |
| InChIKey | WMBHJONOSHBKTJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |