About thieno[3,2-b]thiophene-5-carbohydrazide
thieno[3,2-b]thiophene-5-carbohydrazide (PubChem CID 2739789) has the molecular formula C7H6N2OS2
and a molecular weight of 198.27 g/mol. Its IUPAC name is thieno[3,2-b]thiophene-5-carbohydrazide.
Molecular Properties
| Compound Name | thieno[3,2-b]thiophene-5-carbohydrazide |
| PubChem CID | 2739789 |
| Molecular Formula | C7H6N2OS2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | thieno[3,2-b]thiophene-5-carbohydrazide |
| SMILES | NNC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C7H6N2OS2/c8-9-7(10)6-3-5-4(12-6)1-2-11-5/h1-3H,8H2,(H,9,10) |
| InChIKey | GLEYHEKHGPYQOB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,2-b]thiophene-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-b]thiophene-5-carbohydrazide?
The IUPAC name of thieno[3,2-b]thiophene-5-carbohydrazide (CID 2739789) is thieno[3,2-b]thiophene-5-carbohydrazide.
What is the SMILES notation for thieno[3,2-b]thiophene-5-carbohydrazide?
The canonical SMILES for thieno[3,2-b]thiophene-5-carbohydrazide is NNC(=O)c1cc2sccc2s1.
What is the InChIKey of thieno[3,2-b]thiophene-5-carbohydrazide?
The InChIKey is GLEYHEKHGPYQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS2/c8-9-7(10)6-3-5-4(12-6)1-2-11-5/h1-3H,8H2,(H,9,10).
What are the key properties of thieno[3,2-b]thiophene-5-carbohydrazide?
thieno[3,2-b]thiophene-5-carbohydrazide has a molecular weight of 198.27 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]thiophene-5-carbohydrazide is sourced from PubChem (CID 2739789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).