About 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole
2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole (PubChem CID 2739829) has the molecular formula C9H6N2OS2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole |
| PubChem CID | 2739829 |
| Molecular Formula | C9H6N2OS2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2cc3sccc3s2)o1 |
| InChI | InChI=1S/C9H6N2OS2/c1-5-10-11-9(12-5)8-4-7-6(14-8)2-3-13-7/h2-4H,1H3 |
| InChIKey | RAVQKGLZVDUEQN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole?
The IUPAC name of 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole (CID 2739829) is 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole.
What is the SMILES notation for 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole?
The canonical SMILES for 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole is Cc1nnc(-c2cc3sccc3s2)o1.
What is the InChIKey of 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole?
The InChIKey is RAVQKGLZVDUEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2OS2/c1-5-10-11-9(12-5)8-4-7-6(14-8)2-3-13-7/h2-4H,1H3.
What are the key properties of 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole?
2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole has a molecular weight of 222.29 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-thieno[3,2-b]thiophen-5-yl-1,3,4-oxadiazole is sourced from PubChem (CID 2739829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).