About N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine
N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine (PubChem CID 2739831) has the molecular formula C17H9F6NS2
and a molecular weight of 405.39 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine |
| PubChem CID | 2739831 |
| Molecular Formula | C17H9F6NS2 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine |
| SMILES | FC(F)(F)c1cc(/N=C/c2ccc(-c3cccs3)s2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F6NS2/c18-16(19,20)10-6-11(17(21,22)23)8-12(7-10)24-9-13-3-4-15(26-13)14-2-1-5-25-14/h1-9H/b24-9+ |
| InChIKey | IVFICHFFPIFXNI-PGGKNCGUSA-N |
| XLogP | 7.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine (CID 2739831) is N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine is FC(F)(F)c1cc(/N=C/c2ccc(-c3cccs3)s2)cc(C(F)(F)F)c1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine?
The InChIKey is IVFICHFFPIFXNI-PGGKNCGUSA-N. The full InChI is InChI=1S/C17H9F6NS2/c18-16(19,20)10-6-11(17(21,22)23)8-12(7-10)24-9-13-3-4-15(26-13)14-2-1-5-25-14/h1-9H/b24-9+.
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine?
N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine has a molecular weight of 405.39 g/mol, XLogP of 7.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-1-(5-thiophen-2-ylthiophen-2-yl)methanimine is sourced from PubChem (CID 2739831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).