About 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one
4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one (PubChem CID 2739865) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one.
Molecular Properties
| Compound Name | 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one |
| PubChem CID | 2739865 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one |
| SMILES | Cc1c2n(c3ccccc13)CCC2=O |
| InChI | InChI=1S/C12H11NO/c1-8-9-4-2-3-5-10(9)13-7-6-11(14)12(8)13/h2-5H,6-7H2,1H3 |
| InChIKey | XZSHIWTYVYPCRW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one?
The IUPAC name of 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one (CID 2739865) is 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one.
What is the SMILES notation for 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one?
The canonical SMILES for 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one is Cc1c2n(c3ccccc13)CCC2=O.
What is the InChIKey of 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one?
The InChIKey is XZSHIWTYVYPCRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-8-9-4-2-3-5-10(9)13-7-6-11(14)12(8)13/h2-5H,6-7H2,1H3.
What are the key properties of 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one?
4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one has a molecular weight of 185.23 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2-dihydropyrrolo[1,2-a]indol-3-one is sourced from PubChem (CID 2739865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).