C20H17F3N2O2 — CID 2739969
(4-methoxyphenyl)-[1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 2739969) has the molecular formula C20H17F3N2O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is (4-methoxyphenyl)-[1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 2739969 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (4-methoxyphenyl)-[1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCc3c([nH]c4ccccc34)C2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O2/c1-27-13-8-6-12(7-9-13)19(26)25-11-10-15-14-4-2-3-5-16(14)24-17(15)18(25)20(21,22)23/h2-9,18,24H,10-11H2,1H3 |
| InChIKey | BQTPANGKDZIFAG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|