About 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole
2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole (PubChem CID 2740110) has the molecular formula C7H7N3S2
and a molecular weight of 197.29 g/mol. Its IUPAC name is 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole |
| PubChem CID | 2740110 |
| Molecular Formula | C7H7N3S2 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole |
| SMILES | CSc1cc(-c2nccs2)[nH]n1 |
| InChI | InChI=1S/C7H7N3S2/c1-11-6-4-5(9-10-6)7-8-2-3-12-7/h2-4H,1H3,(H,9,10) |
| InChIKey | VPXHHISDYQDPOJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole?
The IUPAC name of 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole (CID 2740110) is 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole.
What is the SMILES notation for 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole?
The canonical SMILES for 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole is CSc1cc(-c2nccs2)[nH]n1.
What is the InChIKey of 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole?
The InChIKey is VPXHHISDYQDPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S2/c1-11-6-4-5(9-10-6)7-8-2-3-12-7/h2-4H,1H3,(H,9,10).
What are the key properties of 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole?
2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole has a molecular weight of 197.29 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylsulfanyl-1H-pyrazol-5-yl)-1,3-thiazole is sourced from PubChem (CID 2740110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).