About 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine
1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine (PubChem CID 27402) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine.
Molecular Properties
| Compound Name | 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine |
| PubChem CID | 27402 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine |
| SMILES | CCc1cc(OC)c(CC(C)N)cc1OC |
| InChI | InChI=1S/C13H21NO2/c1-5-10-7-13(16-4)11(6-9(2)14)8-12(10)15-3/h7-9H,5-6,14H2,1-4H3 |
| InChIKey | HXJKWPGVENNMCC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine?
The IUPAC name of 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine (CID 27402) is 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine.
What is the SMILES notation for 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine?
The canonical SMILES for 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine is CCc1cc(OC)c(CC(C)N)cc1OC.
What is the InChIKey of 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine?
The InChIKey is HXJKWPGVENNMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-5-10-7-13(16-4)11(6-9(2)14)8-12(10)15-3/h7-9H,5-6,14H2,1-4H3.
What are the key properties of 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine?
1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine has a molecular weight of 223.32 g/mol, XLogP of 2.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine is sourced from PubChem (CID 27402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).