C16H10F4O2S — CID 2740333
4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1-benzofuran (PubChem CID 2740333) has the molecular formula C16H10F4O2S and a molecular weight of 342.31 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1-benzofuran.
| Compound Name | 4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1-benzofuran |
|---|---|
| PubChem CID | 2740333 |
| Molecular Formula | C16H10F4O2S |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1-benzofuran |
| SMILES | COc1ccc(SCc2cc3c(F)c(F)c(F)c(F)c3o2)cc1 |
| InChI | InChI=1S/C16H10F4O2S/c1-21-8-2-4-10(5-3-8)23-7-9-6-11-12(17)13(18)14(19)15(20)16(11)22-9/h2-6H,7H2,1H3 |
| InChIKey | CJXUGSARFFVHAA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|