C16H7F7O3S — CID 2740337
4,5,6,7-tetrafluoro-2-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-1-benzofuran (PubChem CID 2740337) has the molecular formula C16H7F7O3S and a molecular weight of 412.28 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-1-benzofuran.
| Compound Name | 4,5,6,7-tetrafluoro-2-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-1-benzofuran |
|---|---|
| PubChem CID | 2740337 |
| Molecular Formula | C16H7F7O3S |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-1-benzofuran |
| SMILES | O=S(=O)(Cc1cc2c(F)c(F)c(F)c(F)c2o1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H7F7O3S/c17-11-10-5-8(26-15(10)14(20)13(19)12(11)18)6-27(24,25)9-3-1-2-7(4-9)16(21,22)23/h1-5H,6H2 |
| InChIKey | JKMVDUCRAPHQQP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|