C14H13N3O5S — CID 27404541
2-hydroxy-5-[[2-[(2R)-3-oxo-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]acetyl]amino]benzoic acid (PubChem CID 27404541) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-[(2R)-3-oxo-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]acetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[2-[(2R)-3-oxo-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 27404541 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-hydroxy-5-[[2-[(2R)-3-oxo-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]acetyl]amino]benzoic acid |
| SMILES | O=C(C[C@H]1SC2=NCCN2C1=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H13N3O5S/c18-9-2-1-7(5-8(9)13(21)22)16-11(19)6-10-12(20)17-4-3-15-14(17)23-10/h1-2,5,10,18H,3-4,6H2,(H,16,19)(H,21,22)/t10-/m1/s1 |
| InChIKey | JIXQGMKJELDANA-SNVBAGLBSA-N |
| XLogP | 0.73 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|