C17H13Cl2F3N2 — CID 2740493
2,6-dichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(trifluoromethyl)aniline (PubChem CID 2740493) has the molecular formula C17H13Cl2F3N2 and a molecular weight of 373.21 g/mol. Its IUPAC name is 2,6-dichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-dichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 2740493 |
| Molecular Formula | C17H13Cl2F3N2 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2,6-dichloro-N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(Cl)c(NN=C2CCCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2F3N2/c18-13-8-11(17(20,21)22)9-14(19)16(13)24-23-15-7-3-5-10-4-1-2-6-12(10)15/h1-2,4,6,8-9,24H,3,5,7H2 |
| InChIKey | LOGJDNRPTIDJEH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|