About N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide
N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 2740553) has the molecular formula C9H6Cl2N2OS2
and a molecular weight of 293.20 g/mol. Its IUPAC name is N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 2740553 |
| Molecular Formula | C9H6Cl2N2OS2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2cc(Cl)c(Cl)s2)cs1 |
| InChI | InChI=1S/C9H6Cl2N2OS2/c1-4(14)12-9-13-6(3-15-9)7-2-5(10)8(11)16-7/h2-3H,1H3,(H,12,13,14) |
| InChIKey | MDZDHZNHYGFGHT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide (CID 2740553) is N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(-c2cc(Cl)c(Cl)s2)cs1.
What is the InChIKey of N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is MDZDHZNHYGFGHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2N2OS2/c1-4(14)12-9-13-6(3-15-9)7-2-5(10)8(11)16-7/h2-3H,1H3,(H,12,13,14).
What are the key properties of N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide?
N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 293.20 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4,5-dichlorothiophen-2-yl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 2740553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).