About 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene
3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene (PubChem CID 2740586) has the molecular formula C8H2Br4S2
and a molecular weight of 481.85 g/mol. Its IUPAC name is 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene.
Analyze 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene?
The IUPAC name of 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene (CID 2740586) is 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene.
What is the SMILES notation for 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene?
The canonical SMILES for 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene is Brc1cc(Br)c(-c2sc(Br)cc2Br)s1.
What is the InChIKey of 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene?
The InChIKey is MOMHMPZSZNZLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Br4S2/c9-3-1-5(11)13-7(3)8-4(10)2-6(12)14-8/h1-2H.
What are the key properties of 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene?
3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene has a molecular weight of 481.85 g/mol, XLogP of 6.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene is sourced from PubChem (CID 2740586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).