About 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one
2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 2740600) has the molecular formula C13H11NO2S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| PubChem CID | 2740600 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | O=C1CC(c2ccco2)Sc2ccccc2N1 |
| InChI | InChI=1S/C13H11NO2S/c15-13-8-12(10-5-3-7-16-10)17-11-6-2-1-4-9(11)14-13/h1-7,12H,8H2,(H,14,15) |
| InChIKey | MNZVCRXTLKYQGL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The IUPAC name of 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CID 2740600) is 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
What is the SMILES notation for 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The canonical SMILES for 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one is O=C1CC(c2ccco2)Sc2ccccc2N1.
What is the InChIKey of 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The InChIKey is MNZVCRXTLKYQGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2S/c15-13-8-12(10-5-3-7-16-10)17-11-6-2-1-4-9(11)14-13/h1-7,12H,8H2,(H,14,15).
What are the key properties of 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one has a molecular weight of 245.30 g/mol, XLogP of 3.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one is sourced from PubChem (CID 2740600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).