C19H17F2NO2 — CID 2740740
[1-(2,6-difluorobenzoyl)piperidin-4-yl]-phenylmethanone (PubChem CID 2740740) has the molecular formula C19H17F2NO2 and a molecular weight of 329.35 g/mol. Its IUPAC name is [1-(2,6-difluorobenzoyl)piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-(2,6-difluorobenzoyl)piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 2740740 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [1-(2,6-difluorobenzoyl)piperidin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCN(C(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H17F2NO2/c20-15-7-4-8-16(21)17(15)19(24)22-11-9-14(10-12-22)18(23)13-5-2-1-3-6-13/h1-8,14H,9-12H2 |
| InChIKey | FYVUYCZFLNTZRN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |