About [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone
[1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone (PubChem CID 2740746) has the molecular formula C20H17F6NO3S
and a molecular weight of 465.42 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone |
| PubChem CID | 2740746 |
| Molecular Formula | C20H17F6NO3S |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H17F6NO3S/c21-19(22,23)15-10-16(20(24,25)26)12-17(11-15)31(29,30)27-8-6-14(7-9-27)18(28)13-4-2-1-3-5-13/h1-5,10-12,14H,6-9H2 |
| InChIKey | MQFOZFCAWOISRC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone?
The IUPAC name of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone (CID 2740746) is [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone.
What is the SMILES notation for [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone?
The canonical SMILES for [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone is O=C(c1ccccc1)C1CCN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1.
What is the InChIKey of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone?
The InChIKey is MQFOZFCAWOISRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F6NO3S/c21-19(22,23)15-10-16(20(24,25)26)12-17(11-15)31(29,30)27-8-6-14(7-9-27)18(28)13-4-2-1-3-5-13/h1-5,10-12,14H,6-9H2.
What are the key properties of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone?
[1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone has a molecular weight of 465.42 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-phenylmethanone is sourced from PubChem (CID 2740746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).