About 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid
2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid (PubChem CID 2740771) has the molecular formula C13H11NO4S
and a molecular weight of 277.30 g/mol. Its IUPAC name is 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid |
| PubChem CID | 2740771 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid |
| SMILES | Cc1nc(C)c(C(=O)O)c(-c2cccs2)c1C(=O)O |
| InChI | InChI=1S/C13H11NO4S/c1-6-9(12(15)16)11(8-4-3-5-19-8)10(13(17)18)7(2)14-6/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ICZSZWFKBXSBAV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid?
The IUPAC name of 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid (CID 2740771) is 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid is Cc1nc(C)c(C(=O)O)c(-c2cccs2)c1C(=O)O.
What is the InChIKey of 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid?
The InChIKey is ICZSZWFKBXSBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO4S/c1-6-9(12(15)16)11(8-4-3-5-19-8)10(13(17)18)7(2)14-6/h3-5H,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid?
2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid has a molecular weight of 277.30 g/mol, XLogP of 2.82, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-thiophen-2-ylpyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 2740771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).