About ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate
ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate (PubChem CID 2740823) has the molecular formula C22H17F6NO2
and a molecular weight of 441.37 g/mol. Its IUPAC name is ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate |
| PubChem CID | 2740823 |
| Molecular Formula | C22H17F6NO2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)n(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H17F6NO2/c1-3-31-20(30)18-9-13(2)29(19(18)14-7-5-4-6-8-14)17-11-15(21(23,24)25)10-16(12-17)22(26,27)28/h4-12H,3H2,1-2H3 |
| InChIKey | GUQYLPMGODNVAA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate?
The IUPAC name of ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate (CID 2740823) is ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate.
What is the SMILES notation for ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate?
The canonical SMILES for ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate is CCOC(=O)c1cc(C)n(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1ccccc1.
What is the InChIKey of ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate?
The InChIKey is GUQYLPMGODNVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F6NO2/c1-3-31-20(30)18-9-13(2)29(19(18)14-7-5-4-6-8-14)17-11-15(21(23,24)25)10-16(12-17)22(26,27)28/h4-12H,3H2,1-2H3.
What are the key properties of ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate?
ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate has a molecular weight of 441.37 g/mol, XLogP of 6.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-phenylpyrrole-3-carboxylate is sourced from PubChem (CID 2740823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).