About 5H-pyrrolo[1,2-a]quinoxalin-4-one
5H-pyrrolo[1,2-a]quinoxalin-4-one (PubChem CID 2740936) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 5H-pyrrolo[1,2-a]quinoxalin-4-one.
Molecular Properties
| Compound Name | 5H-pyrrolo[1,2-a]quinoxalin-4-one |
| PubChem CID | 2740936 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 5H-pyrrolo[1,2-a]quinoxalin-4-one |
| SMILES | O=c1[nH]c2ccccc2n2cccc12 |
| InChI | InChI=1S/C11H8N2O/c14-11-10-6-3-7-13(10)9-5-2-1-4-8(9)12-11/h1-7H,(H,12,14) |
| InChIKey | LINHQLFBBDHSEJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-pyrrolo[1,2-a]quinoxalin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[1,2-a]quinoxalin-4-one?
The IUPAC name of 5H-pyrrolo[1,2-a]quinoxalin-4-one (CID 2740936) is 5H-pyrrolo[1,2-a]quinoxalin-4-one.
What is the SMILES notation for 5H-pyrrolo[1,2-a]quinoxalin-4-one?
The canonical SMILES for 5H-pyrrolo[1,2-a]quinoxalin-4-one is O=c1[nH]c2ccccc2n2cccc12.
What is the InChIKey of 5H-pyrrolo[1,2-a]quinoxalin-4-one?
The InChIKey is LINHQLFBBDHSEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c14-11-10-6-3-7-13(10)9-5-2-1-4-8(9)12-11/h1-7H,(H,12,14).
What are the key properties of 5H-pyrrolo[1,2-a]quinoxalin-4-one?
5H-pyrrolo[1,2-a]quinoxalin-4-one has a molecular weight of 184.20 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[1,2-a]quinoxalin-4-one is sourced from PubChem (CID 2740936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).