C18H13NO4S — CID 27409687
2-[(E)-[3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 27409687) has the molecular formula C18H13NO4S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[(E)-[3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 27409687 |
| Molecular Formula | C18H13NO4S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-[(E)-[3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | Cc1ccc(N2C(=O)S/C(=C/c3ccccc3C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C18H13NO4S/c1-11-6-8-13(9-7-11)19-16(20)15(24-18(19)23)10-12-4-2-3-5-14(12)17(21)22/h2-10H,1H3,(H,21,22)/b15-10+ |
| InChIKey | AHAMBUZLJXRFAL-XNTDXEJSSA-N |
| XLogP | 3.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|