About 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole
2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 2741038) has the molecular formula C19H12Cl2F3NS
and a molecular weight of 414.28 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| PubChem CID | 2741038 |
| Molecular Formula | C19H12Cl2F3NS |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | FC(F)(F)c1ccc(-c2csc(C3(c4ccc(Cl)cc4Cl)CC3)n2)cc1 |
| InChI | InChI=1S/C19H12Cl2F3NS/c20-13-5-6-14(15(21)9-13)18(7-8-18)17-25-16(10-26-17)11-1-3-12(4-2-11)19(22,23)24/h1-6,9-10H,7-8H2 |
| InChIKey | HEMFXLUXQRHCLQ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole?
The IUPAC name of 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CID 2741038) is 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole.
What is the SMILES notation for 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole?
The canonical SMILES for 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole is FC(F)(F)c1ccc(-c2csc(C3(c4ccc(Cl)cc4Cl)CC3)n2)cc1.
What is the InChIKey of 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole?
The InChIKey is HEMFXLUXQRHCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2F3NS/c20-13-5-6-14(15(21)9-13)18(7-8-18)17-25-16(10-26-17)11-1-3-12(4-2-11)19(22,23)24/h1-6,9-10H,7-8H2.
What are the key properties of 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole?
2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole has a molecular weight of 414.28 g/mol, XLogP of 7.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-dichlorophenyl)cyclopropyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole is sourced from PubChem (CID 2741038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).