About 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one
2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one (PubChem CID 2741097) has the molecular formula C17H11Cl2F3N4O
and a molecular weight of 415.20 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one |
| PubChem CID | 2741097 |
| Molecular Formula | C17H11Cl2F3N4O |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(=O)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C17H11Cl2F3N4O/c1-9-14(24-23-11-5-3-2-4-6-11)16(27)26(25-9)15-12(18)7-10(8-13(15)19)17(20,21)22/h2-8,25H,1H3/b24-23+ |
| InChIKey | BCYCWPVDKBJHRI-WCWDXBQESA-N |
| XLogP | 6.22 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one?
The IUPAC name of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one (CID 2741097) is 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one.
What is the SMILES notation for 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one?
The canonical SMILES for 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one is Cc1[nH]n(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(=O)c1/N=N/c1ccccc1.
What is the InChIKey of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one?
The InChIKey is BCYCWPVDKBJHRI-WCWDXBQESA-N. The full InChI is InChI=1S/C17H11Cl2F3N4O/c1-9-14(24-23-11-5-3-2-4-6-11)16(27)26(25-9)15-12(18)7-10(8-13(15)19)17(20,21)22/h2-8,25H,1H3/b24-23+.
What are the key properties of 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one?
2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one has a molecular weight of 415.20 g/mol, XLogP of 6.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-methyl-4-phenyldiazenyl-1H-pyrazol-3-one is sourced from PubChem (CID 2741097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).