About [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone
[1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone (PubChem CID 2741116) has the molecular formula C21H19F6NO3S
and a molecular weight of 479.44 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone |
| PubChem CID | 2741116 |
| Molecular Formula | C21H19F6NO3S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCN(S(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H19F6NO3S/c1-13-2-4-14(5-3-13)19(29)15-6-8-28(9-7-15)32(30,31)18-11-16(20(22,23)24)10-17(12-18)21(25,26)27/h2-5,10-12,15H,6-9H2,1H3 |
| InChIKey | IKCUNGIFVNAWRQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone?
The IUPAC name of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone (CID 2741116) is [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone.
What is the SMILES notation for [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone?
The canonical SMILES for [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone is Cc1ccc(C(=O)C2CCN(S(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)cc1.
What is the InChIKey of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone?
The InChIKey is IKCUNGIFVNAWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F6NO3S/c1-13-2-4-14(5-3-13)19(29)15-6-8-28(9-7-15)32(30,31)18-11-16(20(22,23)24)10-17(12-18)21(25,26)27/h2-5,10-12,15H,6-9H2,1H3.
What are the key properties of [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone?
[1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone has a molecular weight of 479.44 g/mol, XLogP of 5.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone is sourced from PubChem (CID 2741116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).