C18H11Cl2NO4S2 — CID 27411243
2-[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 27411243) has the molecular formula C18H11Cl2NO4S2 and a molecular weight of 440.33 g/mol. Its IUPAC name is 2-[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 27411243 |
| Molecular Formula | C18H11Cl2NO4S2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 438.95 |
| IUPAC Name | 2-[4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2/SC(=S)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H11Cl2NO4S2/c19-13-6-3-11(8-14(13)20)21-17(24)15(27-18(21)26)7-10-1-4-12(5-2-10)25-9-16(22)23/h1-8H,9H2,(H,22,23)/b15-7+ |
| InChIKey | LAAVOMAQZZALII-VIZOYTHASA-N |
| XLogP | 4.86 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|