C21H16F4N2O — CID 2741192
1-[4-(2-fluorophenyl)phenyl]-N-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-imine (PubChem CID 2741192) has the molecular formula C21H16F4N2O and a molecular weight of 388.36 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)phenyl]-N-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-imine.
| Compound Name | 1-[4-(2-fluorophenyl)phenyl]-N-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-imine |
|---|---|
| PubChem CID | 2741192 |
| Molecular Formula | C21H16F4N2O |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[4-(2-fluorophenyl)phenyl]-N-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-1-imine |
| SMILES | CCC(=NOc1ccc(C(F)(F)F)cn1)c1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H16F4N2O/c1-2-19(27-28-20-12-11-16(13-26-20)21(23,24)25)15-9-7-14(8-10-15)17-5-3-4-6-18(17)22/h3-13H,2H2,1H3 |
| InChIKey | MFXJLBMJYSWOKN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|