About N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide
N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide (PubChem CID 2741215) has the molecular formula C16H9ClF6N2O2
and a molecular weight of 410.70 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide.
Molecular Properties
| Compound Name | N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide |
| PubChem CID | 2741215 |
| Molecular Formula | C16H9ClF6N2O2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H9ClF6N2O2/c17-12-3-1-8(2-4-12)13(26)24-25-14(27)9-5-10(15(18,19)20)7-11(6-9)16(21,22)23/h1-7H,(H,24,26)(H,25,27) |
| InChIKey | XUKGZFZNXGUTCP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide?
The IUPAC name of N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide (CID 2741215) is N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide.
What is the SMILES notation for N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide?
The canonical SMILES for N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide is O=C(NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(Cl)cc1.
What is the InChIKey of N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide?
The InChIKey is XUKGZFZNXGUTCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClF6N2O2/c17-12-3-1-8(2-4-12)13(26)24-25-14(27)9-5-10(15(18,19)20)7-11(6-9)16(21,22)23/h1-7H,(H,24,26)(H,25,27).
What are the key properties of N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide?
N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide has a molecular weight of 410.70 g/mol, XLogP of 4.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-chlorobenzoyl)-3,5-bis(trifluoromethyl)benzohydrazide is sourced from PubChem (CID 2741215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).