About [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate
[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate (PubChem CID 2741253) has the molecular formula C13H10FN3O2S2
and a molecular weight of 323.37 g/mol. Its IUPAC name is [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate.
Molecular Properties
| Compound Name | [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate |
| PubChem CID | 2741253 |
| Molecular Formula | C13H10FN3O2S2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate |
| SMILES | Cc1nnsc1C(=O)ON=C1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C13H10FN3O2S2/c1-7-12(21-17-15-7)13(18)19-16-10-4-5-20-11-3-2-8(14)6-9(10)11/h2-3,6H,4-5H2,1H3 |
| InChIKey | PPUBKYGDPAKKHS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate?
The IUPAC name of [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate (CID 2741253) is [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate.
What is the SMILES notation for [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate?
The canonical SMILES for [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate is Cc1nnsc1C(=O)ON=C1CCSc2ccc(F)cc21.
What is the InChIKey of [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate?
The InChIKey is PPUBKYGDPAKKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN3O2S2/c1-7-12(21-17-15-7)13(18)19-16-10-4-5-20-11-3-2-8(14)6-9(10)11/h2-3,6H,4-5H2,1H3.
What are the key properties of [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate?
[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate has a molecular weight of 323.37 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino] 4-methylthiadiazole-5-carboxylate is sourced from PubChem (CID 2741253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).