About 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea
1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea (PubChem CID 2741281) has the molecular formula C18H10F8N4O
and a molecular weight of 450.29 g/mol. Its IUPAC name is 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea |
| PubChem CID | 2741281 |
| Molecular Formula | C18H10F8N4O |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H10F8N4O/c19-9-1-6-13(12(20)7-9)28-16(31)27-10-2-4-11(5-3-10)30-15(18(24,25)26)8-14(29-30)17(21,22)23/h1-8H,(H2,27,28,31) |
| InChIKey | LHWHUDZZGWCCLX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea?
The IUPAC name of 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea (CID 2741281) is 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea.
What is the SMILES notation for 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea?
The canonical SMILES for 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea is O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)Nc1ccc(F)cc1F.
What is the InChIKey of 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea?
The InChIKey is LHWHUDZZGWCCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F8N4O/c19-9-1-6-13(12(20)7-9)28-16(31)27-10-2-4-11(5-3-10)30-15(18(24,25)26)8-14(29-30)17(21,22)23/h1-8H,(H2,27,28,31).
What are the key properties of 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea?
1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea has a molecular weight of 450.29 g/mol, XLogP of 5.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-(2,4-difluorophenyl)urea is sourced from PubChem (CID 2741281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).