About 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene
2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene (PubChem CID 2741285) has the molecular formula C16H8Cl2N2O4S3
and a molecular weight of 459.36 g/mol. Its IUPAC name is 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene.
Molecular Properties
| Compound Name | 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene |
| PubChem CID | 2741285 |
| Molecular Formula | C16H8Cl2N2O4S3 |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 457.90 |
| IUPAC Name | 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene |
| SMILES | O=[N+]([O-])c1c(Sc2ccc(Cl)cc2)sc(Sc2ccc(Cl)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H8Cl2N2O4S3/c17-9-1-5-11(6-2-9)25-15-13(19(21)22)14(20(23)24)16(27-15)26-12-7-3-10(18)4-8-12/h1-8H |
| InChIKey | TXPDPALEMAYKGV-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene?
The IUPAC name of 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene (CID 2741285) is 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene.
What is the SMILES notation for 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene?
The canonical SMILES for 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene is O=[N+]([O-])c1c(Sc2ccc(Cl)cc2)sc(Sc2ccc(Cl)cc2)c1[N+](=O)[O-].
What is the InChIKey of 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene?
The InChIKey is TXPDPALEMAYKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Cl2N2O4S3/c17-9-1-5-11(6-2-9)25-15-13(19(21)22)14(20(23)24)16(27-15)26-12-7-3-10(18)4-8-12/h1-8H.
What are the key properties of 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene?
2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene has a molecular weight of 459.36 g/mol, XLogP of 7.17, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[(4-chlorophenyl)sulfanyl]-3,4-dinitrothiophene is sourced from PubChem (CID 2741285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).