About (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone
(2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 2741468) has the molecular formula C18H15F4NO3S
and a molecular weight of 401.38 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone.
Molecular Properties
| Compound Name | (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone |
| PubChem CID | 2741468 |
| Molecular Formula | C18H15F4NO3S |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1F)C1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H15F4NO3S/c19-12-1-3-14(15(21)9-12)18(24)11-5-7-23(8-6-11)27(25,26)17-4-2-13(20)10-16(17)22/h1-4,9-11H,5-8H2 |
| InChIKey | FCCFRXTWNYPFPK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone?
The IUPAC name of (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone (CID 2741468) is (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone.
What is the SMILES notation for (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone?
The canonical SMILES for (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone is O=C(c1ccc(F)cc1F)C1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1.
What is the InChIKey of (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone?
The InChIKey is FCCFRXTWNYPFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F4NO3S/c19-12-1-3-14(15(21)9-12)18(24)11-5-7-23(8-6-11)27(25,26)17-4-2-13(20)10-16(17)22/h1-4,9-11H,5-8H2.
What are the key properties of (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone?
(2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone has a molecular weight of 401.38 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl)-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methanone is sourced from PubChem (CID 2741468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).