C13H16N2O3S — CID 2741492
N-benzyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 2741492) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-benzyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-benzyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 2741492 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-benzyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H16N2O3S/c1-10-13(11(2)18-14-10)19(16,17)15(3)9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3 |
| InChIKey | VPVLGOCDWKWCRR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |